What is the 2-Vinylnaphthalene?

2-Vinylnaphthalene is Tan powder, while it's Molecular Formula is C12H10 . Tan powder Used in Plastics and Resins Production: 2-Vinylnaphthalene is used as a precursor in the synthesis of various polymers, contributing to the development of plastics and resins. Its unique structure allows for the creation of materials with specific properties tailored for different applications. Used in Pharmaceutical Manufacturing: In the pharmaceutical industry, 2-Vinylnaphthalene serves as an intermediate in the production of various medications. Its chemical properties make it a valuable component in the synthesis of complex drug molecules. Used in Fragrance Industry: 2-Vinylnaphthalene is utilized as a monomer for the production of vinyl naphthalene resins, which are essential in the formulation of fragrances. Its distinct floral scent makes it a desirable ingredient in creating a wide range of scents for perfumes and other aromatic products. However, it is important to note that 2-Vinylnaphthalene is a potential irritant. It can cause skin and eye irritation upon contact and may have harmful effects if inhaled, necessitating proper handling and safety measures during its use in various applications.

What is the CAS number for 2-Vinylnaphthalene?

The CAS number of 2-Vinylnaphthalene is 827-54-3.

What is 2-Vinylnaphthalene (827-54-3) used for?

2-Vinylnaphthalene, also known as 2-vinyl-1-naphthalene, is a chemical compound with the formula C12H10. It is a colorless liquid characterized by a sweet, floral odor. As a vinylated naphthalene, it features a vinyl group attached to the naphthalene ring, which makes it a versatile building block in the chemical industry.InChI:InChI=1/C12H10/c1-2-10-7-8-11-5-3-4-6-12(11)9-10/h2-9H,1H2

What is the 2-Vinylnaphthalene?

2-Vinylnaphthalene is Tan powder, while it's Molecular Formula is C12H10 . Tan powder Used in Plastics and Resins Production: 2-Vinylnaphthalene is used as a precursor in the synthesis of various polymers, contributing to the development of plastics and resins. Its unique structure allows for the creation of materials with specific properties tailored for different applications. Used in Pharmaceutical Manufacturing: In the pharmaceutical industry, 2-Vinylnaphthalene serves as an intermediate in the production of various medications. Its chemical properties make it a valuable component in the synthesis of complex drug molecules. Used in Fragrance Industry: 2-Vinylnaphthalene is utilized as a monomer for the production of vinyl naphthalene resins, which are essential in the formulation of fragrances. Its distinct floral scent makes it a desirable ingredient in creating a wide range of scents for perfumes and other aromatic products. However, it is important to note that 2-Vinylnaphthalene is a potential irritant. It can cause skin and eye irritation upon contact and may have harmful effects if inhaled, necessitating proper handling and safety measures during its use in various applications.

What is the CAS number for 2-Vinylnaphthalene?

The CAS number of 2-Vinylnaphthalene is 827-54-3.

What is 2-Vinylnaphthalene (827-54-3) used for?

2-Vinylnaphthalene, also known as 2-vinyl-1-naphthalene, is a chemical compound with the formula C12H10. It is a colorless liquid characterized by a sweet, floral odor. As a vinylated naphthalene, it features a vinyl group attached to the naphthalene ring, which makes it a versatile building block in the chemical industry.InChI:InChI=1/C12H10/c1-2-10-7-8-11-5-3-4-6-12(11)9-10/h2-9H,1H2

827-54-3

2-Vinylnaphthalene

别名：

CasNo.： 827-54-3

分子式： C₁₂H₁₀

分子量： 154.211

储存条件：

在线咨询

中文名称： 2-Vinylnaphthalene

英文名称： 2-Vinylnaphthalene

CasNo.： 827-54-3

分子式： C₁₂H₁₀

分子量： 154.211

Factory sells 2-Vinylnaphthalene 827-54-3 with sufficient production capacity

Molecular Formula:C12H10
Molecular Weight:154.211
Appearance/Colour:Tan powder
Melting Point:64-68 °C(lit.)
Boiling Point:270.9 °C at 760 mmHg
Flash Point:115.5 °C
PSA：0.00000
Density:1.031 g/cm³
LogP:3.48280

2-Vinylnaphthalene(Cas 827-54-3) Usage

General Description

2-Vinylnaphthalene, also known as 2-vinyl-1-naphthalene, is a chemical compound with the formula C12H10. It is a white powder with a sweet, floral odor；

2-Vinylnaphthalene is an important organic compound with a wide range of applications in multiple fields:

Synthesis of high-performance polymers: It serves as a monomer for the synthesis of various polymers with excellent properties. For example, by copolymerizing with other monomers, copolymers with special properties can be prepared, and these polymers are widely used in the fields of plastics, rubber, etc. Through polymerization with suitable monomers, materials with good mechanical properties, thermal stability, and chemical corrosion resistance can be obtained, which can be used for manufacturing auto parts, electronic device casings, and so on.
Preparation of special resins: It is a key raw material for the production of vinyl naphthalene resins. Vinyl naphthalene resins have unique physical and chemical properties, such as good solubility, film-forming property, and adhesiveness. These resins can be applied in industries such as coatings and adhesives, which can improve the performance and quality of products. For instance, in coatings, they can enhance the adhesion and durability of the coating.
In the field of photoresists: In the semiconductor lithography process, 2-vinylnaphthalene and its derivatives can be used to prepare photoresists. Photoresists are key materials in semiconductor manufacturing and are crucial for accurately replicating circuit patterns. The introduction of 2-vinylnaphthalene can improve the photosensitive performance, resolution, and corrosion resistance of photoresists, meeting the higher requirements for photoresist performance in the continuous development of the semiconductor industry.
Pharmaceutical intermediates: In drug synthesis, 2-vinylnaphthalene can serve as an important intermediate. Its unique molecular structure provides a basis for the synthesis of drug molecules with specific biological activities. By chemically modifying and reacting 2-vinylnaphthalene, various compounds with potential medicinal values can be prepared for the development of drugs for treating dif

InChI:InChI=1/C12H10/c1-2-10-7-8-11-5-3-4-6-12(11)9-10/h2-9H,1H2